C32H51N3O6 — CID 67599855
(4-cyclohexylphenyl) 2-[1-(hexylcarbamoyloxy)hexylcarbamoyloxy]piperidine-1-carboxylate (PubChem CID 67599855) has the molecular formula C32H51N3O6 and a molecular weight of 573.78 g/mol. Its IUPAC name is (4-cyclohexylphenyl) 2-[1-(hexylcarbamoyloxy)hexylcarbamoyloxy]piperidine-1-carboxylate.
| Compound Name | (4-cyclohexylphenyl) 2-[1-(hexylcarbamoyloxy)hexylcarbamoyloxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67599855 |
| Molecular Formula | C32H51N3O6 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.38 |
| IUPAC Name | (4-cyclohexylphenyl) 2-[1-(hexylcarbamoyloxy)hexylcarbamoyloxy]piperidine-1-carboxylate |
| SMILES | CCCCCCNC(=O)OC(CCCCC)NC(=O)OC1CCCCN1C(=O)Oc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C32H51N3O6/c1-3-5-7-13-23-33-30(36)40-28(17-9-6-4-2)34-31(37)41-29-18-12-14-24-35(29)32(38)39-27-21-19-26(20-22-27)25-15-10-8-11-16-25/h19-22,25,28-29H,3-18,23-24H2,1-2H3,(H,33,36)(H,34,37) |
| InChIKey | LGOVJTINTFNVCC-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|