C38H57N3O7 — CID 67599493
(4-phenoxyphenyl) 2-[6-(dihexylcarbamoyloxy)hexylcarbamoyloxy]piperidine-1-carboxylate (PubChem CID 67599493) has the molecular formula C38H57N3O7 and a molecular weight of 667.89 g/mol. Its IUPAC name is (4-phenoxyphenyl) 2-[6-(dihexylcarbamoyloxy)hexylcarbamoyloxy]piperidine-1-carboxylate.
| Compound Name | (4-phenoxyphenyl) 2-[6-(dihexylcarbamoyloxy)hexylcarbamoyloxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67599493 |
| Molecular Formula | C38H57N3O7 |
| Molecular Weight | 667.89 g/mol |
| Exact Mass | 667.42 |
| IUPAC Name | (4-phenoxyphenyl) 2-[6-(dihexylcarbamoyloxy)hexylcarbamoyloxy]piperidine-1-carboxylate |
| SMILES | CCCCCCN(CCCCCC)C(=O)OCCCCCCNC(=O)OC1CCCCN1C(=O)Oc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C38H57N3O7/c1-3-5-7-16-28-40(29-17-8-6-4-2)37(43)45-31-19-10-9-15-27-39-36(42)48-35-22-14-18-30-41(35)38(44)47-34-25-23-33(24-26-34)46-32-20-12-11-13-21-32/h11-13,20-21,23-26,35H,3-10,14-19,22,27-31H2,1-2H3,(H,39,42) |
| InChIKey | UZACAFUGHUHUJF-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.89 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|