C33H46N2O6 — CID 173281219
2,3-dihydro-1H-inden-2-yl N-hexylcarbamate;2,3-dihydro-1H-inden-2-yloxycarbonyl(hexyl)carbamic acid (PubChem CID 173281219) has the molecular formula C33H46N2O6 and a molecular weight of 566.74 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl N-hexylcarbamate;2,3-dihydro-1H-inden-2-yloxycarbonyl(hexyl)carbamic acid.
| Compound Name | 2,3-dihydro-1H-inden-2-yl N-hexylcarbamate;2,3-dihydro-1H-inden-2-yloxycarbonyl(hexyl)carbamic acid |
|---|---|
| PubChem CID | 173281219 |
| Molecular Formula | C33H46N2O6 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl N-hexylcarbamate;2,3-dihydro-1H-inden-2-yloxycarbonyl(hexyl)carbamic acid |
| SMILES | CCCCCCN(C(=O)O)C(=O)OC1Cc2ccccc2C1.CCCCCCNC(=O)OC1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H23NO4.C16H23NO2/c1-2-3-4-7-10-18(16(19)20)17(21)22-15-11-13-8-5-6-9-14(13)12-15;1-2-3-4-7-10-17-16(18)19-15-11-13-8-5-6-9-14(13)12-15/h5-6,8-9,15H,2-4,7,10-12H2,1H3,(H,19,20);5-6,8-9,15H,2-4,7,10-12H2,1H3,(H,17,18) |
| InChIKey | WMYLZHRYUHSJJF-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|