C32H45N3O7 — CID 67682169
6-[4-(hexylcarbamoyloxy)piperidine-1-carbonyl]oxyhexyl-(4-phenoxyphenyl)carbamic acid (PubChem CID 67682169) has the molecular formula C32H45N3O7 and a molecular weight of 583.73 g/mol. Its IUPAC name is 6-[4-(hexylcarbamoyloxy)piperidine-1-carbonyl]oxyhexyl-(4-phenoxyphenyl)carbamic acid.
| Compound Name | 6-[4-(hexylcarbamoyloxy)piperidine-1-carbonyl]oxyhexyl-(4-phenoxyphenyl)carbamic acid |
|---|---|
| PubChem CID | 67682169 |
| Molecular Formula | C32H45N3O7 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | 6-[4-(hexylcarbamoyloxy)piperidine-1-carbonyl]oxyhexyl-(4-phenoxyphenyl)carbamic acid |
| SMILES | CCCCCCNC(=O)OC1CCN(C(=O)OCCCCCCN(C(=O)O)c2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C32H45N3O7/c1-2-3-4-10-21-33-30(36)42-29-19-23-34(24-20-29)32(39)40-25-12-6-5-11-22-35(31(37)38)26-15-17-28(18-16-26)41-27-13-8-7-9-14-27/h7-9,13-18,29H,2-6,10-12,19-25H2,1H3,(H,33,36)(H,37,38) |
| InChIKey | SGWPMOOHUAHUPM-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|