C25H31FN2O5 — CID 54271492
(2-fluoro-4-phenoxyphenyl) 4-(hexylcarbamoyloxy)piperidine-1-carboxylate (PubChem CID 54271492) has the molecular formula C25H31FN2O5 and a molecular weight of 458.53 g/mol. Its IUPAC name is (2-fluoro-4-phenoxyphenyl) 4-(hexylcarbamoyloxy)piperidine-1-carboxylate.
| Compound Name | (2-fluoro-4-phenoxyphenyl) 4-(hexylcarbamoyloxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54271492 |
| Molecular Formula | C25H31FN2O5 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (2-fluoro-4-phenoxyphenyl) 4-(hexylcarbamoyloxy)piperidine-1-carboxylate |
| SMILES | CCCCCCNC(=O)OC1CCN(C(=O)Oc2ccc(Oc3ccccc3)cc2F)CC1 |
| InChI | InChI=1S/C25H31FN2O5/c1-2-3-4-8-15-27-24(29)32-20-13-16-28(17-14-20)25(30)33-23-12-11-21(18-22(23)26)31-19-9-6-5-7-10-19/h5-7,9-12,18,20H,2-4,8,13-17H2,1H3,(H,27,29) |
| InChIKey | RKLKGHJMVPYNDK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|