C25H32N2O6 — CID 67599393
(4-phenoxyphenyl) 2-(6-hydroxyhexylcarbamoyloxy)piperidine-1-carboxylate (PubChem CID 67599393) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is (4-phenoxyphenyl) 2-(6-hydroxyhexylcarbamoyloxy)piperidine-1-carboxylate.
| Compound Name | (4-phenoxyphenyl) 2-(6-hydroxyhexylcarbamoyloxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67599393 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (4-phenoxyphenyl) 2-(6-hydroxyhexylcarbamoyloxy)piperidine-1-carboxylate |
| SMILES | O=C(NCCCCCCO)OC1CCCCN1C(=O)Oc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H32N2O6/c28-19-9-2-1-7-17-26-24(29)33-23-12-6-8-18-27(23)25(30)32-22-15-13-21(14-16-22)31-20-10-4-3-5-11-20/h3-5,10-11,13-16,23,28H,1-2,6-9,12,17-19H2,(H,26,29) |
| InChIKey | SVYFXKHYFMCYOR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|