C26H30O5 — CID 67602407
4-(3,4-dimethoxyphenyl)-4-[4-[(4-methoxy-1-bicyclo[2.2.1]heptanyl)oxy]phenyl]but-3-en-2-one (PubChem CID 67602407) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-4-[4-[(4-methoxy-1-bicyclo[2.2.1]heptanyl)oxy]phenyl]but-3-en-2-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-4-[4-[(4-methoxy-1-bicyclo[2.2.1]heptanyl)oxy]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 67602407 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-4-[4-[(4-methoxy-1-bicyclo[2.2.1]heptanyl)oxy]phenyl]but-3-en-2-one |
| SMILES | COc1ccc(C(=CC(C)=O)c2ccc(OC34CCC(OC)(CC3)C4)cc2)cc1OC |
| InChI | InChI=1S/C26H30O5/c1-18(27)15-22(20-7-10-23(28-2)24(16-20)29-3)19-5-8-21(9-6-19)31-26-13-11-25(17-26,30-4)12-14-26/h5-10,15-16H,11-14,17H2,1-4H3 |
| InChIKey | BFIDACNRCXVVCD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|