C24H28N2O3 — CID 67605455
(2R)-2-amino-N-[2-[2-(2-hydroxyethoxy)phenyl]ethyl]-N-methyl-3-naphthalen-1-ylpropanamide (PubChem CID 67605455) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-[2-(2-hydroxyethoxy)phenyl]ethyl]-N-methyl-3-naphthalen-1-ylpropanamide.
| Compound Name | (2R)-2-amino-N-[2-[2-(2-hydroxyethoxy)phenyl]ethyl]-N-methyl-3-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 67605455 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (2R)-2-amino-N-[2-[2-(2-hydroxyethoxy)phenyl]ethyl]-N-methyl-3-naphthalen-1-ylpropanamide |
| SMILES | CN(CCc1ccccc1OCCO)C(=O)[C@H](N)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C24H28N2O3/c1-26(14-13-19-8-3-5-12-23(19)29-16-15-27)24(28)22(25)17-20-10-6-9-18-7-2-4-11-21(18)20/h2-12,22,27H,13-17,25H2,1H3/t22-/m1/s1 |
| InChIKey | PPUBEQUAOZGQOY-JOCHJYFZSA-N |
| XLogP | 2.78 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |