C23H32N4O — CID 67606824
4-(3-tert-butyl-4-cyclopentyloxyphenyl)-2-piperazin-1-ylpyrimidine (PubChem CID 67606824) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is 4-(3-tert-butyl-4-cyclopentyloxyphenyl)-2-piperazin-1-ylpyrimidine.
| Compound Name | 4-(3-tert-butyl-4-cyclopentyloxyphenyl)-2-piperazin-1-ylpyrimidine |
|---|---|
| PubChem CID | 67606824 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 4-(3-tert-butyl-4-cyclopentyloxyphenyl)-2-piperazin-1-ylpyrimidine |
| SMILES | CC(C)(C)c1cc(-c2ccnc(N3CCNCC3)n2)ccc1OC1CCCC1 |
| InChI | InChI=1S/C23H32N4O/c1-23(2,3)19-16-17(8-9-21(19)28-18-6-4-5-7-18)20-10-11-25-22(26-20)27-14-12-24-13-15-27/h8-11,16,18,24H,4-7,12-15H2,1-3H3 |
| InChIKey | AKWLWBAQYAHJQW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |