C22H31N3O — CID 67632902
4-(3-tert-butyl-4-propan-2-yloxyphenyl)-2-(3-methylpyrrolidin-1-yl)pyrimidine (PubChem CID 67632902) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-(3-tert-butyl-4-propan-2-yloxyphenyl)-2-(3-methylpyrrolidin-1-yl)pyrimidine.
| Compound Name | 4-(3-tert-butyl-4-propan-2-yloxyphenyl)-2-(3-methylpyrrolidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 67632902 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 4-(3-tert-butyl-4-propan-2-yloxyphenyl)-2-(3-methylpyrrolidin-1-yl)pyrimidine |
| SMILES | CC1CCN(c2nccc(-c3ccc(OC(C)C)c(C(C)(C)C)c3)n2)C1 |
| InChI | InChI=1S/C22H31N3O/c1-15(2)26-20-8-7-17(13-18(20)22(4,5)6)19-9-11-23-21(24-19)25-12-10-16(3)14-25/h7-9,11,13,15-16H,10,12,14H2,1-6H3 |
| InChIKey | MSKRNCLNJBQRSI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |