C16H13F3N4O3S2 — CID 67607039
N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-7-nitro-5-(trifluoromethyl)-1,3-benzothiazole-2-carboxamide (PubChem CID 67607039) has the molecular formula C16H13F3N4O3S2 and a molecular weight of 430.43 g/mol. Its IUPAC name is N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-7-nitro-5-(trifluoromethyl)-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-7-nitro-5-(trifluoromethyl)-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 67607039 |
| Molecular Formula | C16H13F3N4O3S2 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-7-nitro-5-(trifluoromethyl)-1,3-benzothiazole-2-carboxamide |
| SMILES | Cc1nc(CCNC(=O)c2nc3cc(C(F)(F)F)cc([N+](=O)[O-])c3s2)sc1C |
| InChI | InChI=1S/C16H13F3N4O3S2/c1-7-8(2)27-12(21-7)3-4-20-14(24)15-22-10-5-9(16(17,18)19)6-11(23(25)26)13(10)28-15/h5-6H,3-4H2,1-2H3,(H,20,24) |
| InChIKey | KAKWUBGOYNWBNV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|