C17H8F6N4O3S — CID 170783581
7-nitro-5-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-benzothiazole-2-carboxamide (PubChem CID 170783581) has the molecular formula C17H8F6N4O3S and a molecular weight of 462.33 g/mol. Its IUPAC name is 7-nitro-5-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-benzothiazole-2-carboxamide.
| Compound Name | 7-nitro-5-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 170783581 |
| Molecular Formula | C17H8F6N4O3S |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | 7-nitro-5-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1C(F)(F)F)c1nc2cc(C(F)(F)F)cc([N+](=O)[O-])c2s1 |
| InChI | InChI=1S/C17H8F6N4O3S/c18-16(19,20)9-5-11-13(12(6-9)27(29)30)31-15(25-11)14(28)26-24-7-8-3-1-2-4-10(8)17(21,22)23/h1-7H,(H,26,28) |
| InChIKey | DCSYGKXIGJLGNN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|