C22H14F6N6O5S — CID 127052089
2-[methyl-[(3-nitrobenzoyl)carbamoyl]amino]-4-(trifluoromethyl)-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide (PubChem CID 127052089) has the molecular formula C22H14F6N6O5S and a molecular weight of 588.45 g/mol. Its IUPAC name is 2-[methyl-[(3-nitrobenzoyl)carbamoyl]amino]-4-(trifluoromethyl)-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[methyl-[(3-nitrobenzoyl)carbamoyl]amino]-4-(trifluoromethyl)-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 127052089 |
| Molecular Formula | C22H14F6N6O5S |
| Molecular Weight | 588.45 g/mol |
| Exact Mass | 588.07 |
| IUPAC Name | 2-[methyl-[(3-nitrobenzoyl)carbamoyl]amino]-4-(trifluoromethyl)-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide |
| SMILES | CN(C(=O)NC(=O)c1cccc([N+](=O)[O-])c1)c1nc(C(F)(F)F)c(C(=O)N/N=C/c2ccccc2C(F)(F)F)s1 |
| InChI | InChI=1S/C22H14F6N6O5S/c1-33(19(37)31-17(35)11-6-4-7-13(9-11)34(38)39)20-30-16(22(26,27)28)15(40-20)18(36)32-29-10-12-5-2-3-8-14(12)21(23,24)25/h2-10H,1H3,(H,32,36)(H,31,35,37)/b29-10+ |
| InChIKey | BYXKIPXJETYYOJ-VYVUJPJFSA-N |
| XLogP | 4.84 |
| TPSA | 146.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|