C22H16F5N5O3S — CID 127048311
2-[(2,6-difluorobenzoyl)carbamoyl-methylamino]-4-methyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide (PubChem CID 127048311) has the molecular formula C22H16F5N5O3S and a molecular weight of 525.46 g/mol. Its IUPAC name is 2-[(2,6-difluorobenzoyl)carbamoyl-methylamino]-4-methyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(2,6-difluorobenzoyl)carbamoyl-methylamino]-4-methyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 127048311 |
| Molecular Formula | C22H16F5N5O3S |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | 2-[(2,6-difluorobenzoyl)carbamoyl-methylamino]-4-methyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N(C)C(=O)NC(=O)c2c(F)cccc2F)sc1C(=O)N/N=C/c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H16F5N5O3S/c1-11-17(19(34)31-28-10-12-6-3-4-7-13(12)22(25,26)27)36-21(29-11)32(2)20(35)30-18(33)16-14(23)8-5-9-15(16)24/h3-10H,1-2H3,(H,31,34)(H,30,33,35)/b28-10+ |
| InChIKey | DGGDXONDTKLBIJ-ORBVJSQLSA-N |
| XLogP | 4.50 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|