C22H14F7N5O3S — CID 127048640
2-[(2-fluorobenzoyl)carbamoyl-methylamino]-4-(trifluoromethyl)-N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide (PubChem CID 127048640) has the molecular formula C22H14F7N5O3S and a molecular weight of 561.44 g/mol. Its IUPAC name is 2-[(2-fluorobenzoyl)carbamoyl-methylamino]-4-(trifluoromethyl)-N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(2-fluorobenzoyl)carbamoyl-methylamino]-4-(trifluoromethyl)-N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 127048640 |
| Molecular Formula | C22H14F7N5O3S |
| Molecular Weight | 561.44 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | 2-[(2-fluorobenzoyl)carbamoyl-methylamino]-4-(trifluoromethyl)-N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide |
| SMILES | CN(C(=O)NC(=O)c1ccccc1F)c1nc(C(F)(F)F)c(C(=O)N/N=C/c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C22H14F7N5O3S/c1-34(19(37)32-17(35)13-7-2-3-8-14(13)23)20-31-16(22(27,28)29)15(38-20)18(36)33-30-10-11-5-4-6-12(9-11)21(24,25)26/h2-10H,1H3,(H,33,36)(H,32,35,37)/b30-10+ |
| InChIKey | CWYQENWGPNIIQY-WXMAUWIXSA-N |
| XLogP | 5.07 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|