C23H13F10N5O3S — CID 127052700
N-[(E)-[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-2-[(2-fluorobenzoyl)carbamoyl-methylamino]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 127052700) has the molecular formula C23H13F10N5O3S and a molecular weight of 629.44 g/mol. Its IUPAC name is N-[(E)-[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-2-[(2-fluorobenzoyl)carbamoyl-methylamino]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(E)-[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-2-[(2-fluorobenzoyl)carbamoyl-methylamino]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 127052700 |
| Molecular Formula | C23H13F10N5O3S |
| Molecular Weight | 629.44 g/mol |
| Exact Mass | 629.06 |
| IUPAC Name | N-[(E)-[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-2-[(2-fluorobenzoyl)carbamoyl-methylamino]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | CN(C(=O)NC(=O)c1ccccc1F)c1nc(C(F)(F)F)c(C(=O)N/N=C/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C23H13F10N5O3S/c1-38(19(41)36-17(39)13-4-2-3-5-14(13)24)20-35-16(23(31,32)33)15(42-20)18(40)37-34-9-10-6-11(21(25,26)27)8-12(7-10)22(28,29)30/h2-9H,1H3,(H,37,40)(H,36,39,41)/b34-9+ |
| InChIKey | RMBAUSVSYCJOJE-IELPSJOKSA-N |
| XLogP | 6.09 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.44 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|