C19H13ClF3N3O3S — CID 89469785
2-(4-chlorophenyl)-N-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 89469785) has the molecular formula C19H13ClF3N3O3S and a molecular weight of 455.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 89469785 |
| Molecular Formula | C19H13ClF3N3O3S |
| Molecular Weight | 455.85 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2sc(-c3ccc(Cl)cc3)nc2C(F)(F)F)cc1O |
| InChI | InChI=1S/C19H13ClF3N3O3S/c1-29-14-7-2-10(8-13(14)27)9-24-26-17(28)15-16(19(21,22)23)25-18(30-15)11-3-5-12(20)6-4-11/h2-9,27H,1H3,(H,26,28)/b24-9+ |
| InChIKey | SGKVSFCHXLKOJJ-PGGKNCGUSA-N |
| XLogP | 4.96 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.85 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|