C21H16ClF2N5O3S — CID 127050898
N-[(E)-(2-chlorophenyl)methylideneamino]-2-[(2,6-difluorobenzoyl)carbamoyl-methylamino]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 127050898) has the molecular formula C21H16ClF2N5O3S and a molecular weight of 491.91 g/mol. Its IUPAC name is N-[(E)-(2-chlorophenyl)methylideneamino]-2-[(2,6-difluorobenzoyl)carbamoyl-methylamino]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(E)-(2-chlorophenyl)methylideneamino]-2-[(2,6-difluorobenzoyl)carbamoyl-methylamino]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 127050898 |
| Molecular Formula | C21H16ClF2N5O3S |
| Molecular Weight | 491.91 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | N-[(E)-(2-chlorophenyl)methylideneamino]-2-[(2,6-difluorobenzoyl)carbamoyl-methylamino]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N(C)C(=O)NC(=O)c2c(F)cccc2F)sc1C(=O)N/N=C/c1ccccc1Cl |
| InChI | InChI=1S/C21H16ClF2N5O3S/c1-11-17(19(31)28-25-10-12-6-3-4-7-13(12)22)33-21(26-11)29(2)20(32)27-18(30)16-14(23)8-5-9-15(16)24/h3-10H,1-2H3,(H,28,31)(H,27,30,32)/b25-10+ |
| InChIKey | GPUZMFCAQGPICJ-KIBLKLHPSA-N |
| XLogP | 4.13 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|