C19H14F3N3OS — CID 110527251
5-methyl-2-phenyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-4-carboxamide (PubChem CID 110527251) has the molecular formula C19H14F3N3OS and a molecular weight of 389.40 g/mol. Its IUPAC name is 5-methyl-2-phenyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-4-carboxamide.
| Compound Name | 5-methyl-2-phenyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110527251 |
| Molecular Formula | C19H14F3N3OS |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 5-methyl-2-phenyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1sc(-c2ccccc2)nc1C(=O)N/N=C\c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H14F3N3OS/c1-12-16(24-18(27-12)13-7-3-2-4-8-13)17(26)25-23-11-14-9-5-6-10-15(14)19(20,21)22/h2-11H,1H3,(H,25,26)/b23-11- |
| InChIKey | FJDJATZLOSGOTO-KSEXSDGBSA-N |
| XLogP | 4.90 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|