C13H15N5O3S — CID 75519135
1-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-3-(3-nitro-4-pyridinyl)urea (PubChem CID 75519135) has the molecular formula C13H15N5O3S and a molecular weight of 321.36 g/mol. Its IUPAC name is 1-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-3-(3-nitro-4-pyridinyl)urea.
| Compound Name | 1-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-3-(3-nitro-4-pyridinyl)urea |
|---|---|
| PubChem CID | 75519135 |
| Molecular Formula | C13H15N5O3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-3-(3-nitro-4-pyridinyl)urea |
| SMILES | Cc1nc(CCNC(=O)Nc2ccncc2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C13H15N5O3S/c1-8-9(2)22-12(16-8)4-6-15-13(19)17-10-3-5-14-7-11(10)18(20)21/h3,5,7H,4,6H2,1-2H3,(H2,14,15,17,19) |
| InChIKey | XYAYZRUCICSFCO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|