C8H14N2O6 — CID 67610798
(1-carbamoyloxy-2,2-dihydroxycyclohexyl) carbamate (PubChem CID 67610798) has the molecular formula C8H14N2O6 and a molecular weight of 234.21 g/mol. Its IUPAC name is (1-carbamoyloxy-2,2-dihydroxycyclohexyl) carbamate.
| Compound Name | (1-carbamoyloxy-2,2-dihydroxycyclohexyl) carbamate |
|---|---|
| PubChem CID | 67610798 |
| Molecular Formula | C8H14N2O6 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (1-carbamoyloxy-2,2-dihydroxycyclohexyl) carbamate |
| SMILES | NC(=O)OC1(OC(N)=O)CCCCC1(O)O |
| InChI | InChI=1S/C8H14N2O6/c9-5(11)15-8(16-6(10)12)4-2-1-3-7(8,13)14/h13-14H,1-4H2,(H2,9,11)(H2,10,12) |
| InChIKey | ULWVPSFFMSEBFC-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|