About (2R)-2-aminopropanoic acid;thietane-2-carboxamide
(2R)-2-aminopropanoic acid;thietane-2-carboxamide (PubChem CID 67611109) has the molecular formula C7H14N2O3S
and a molecular weight of 206.27 g/mol. Its IUPAC name is (2R)-2-aminopropanoic acid;thietane-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-2-aminopropanoic acid;thietane-2-carboxamide |
| PubChem CID | 67611109 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (2R)-2-aminopropanoic acid;thietane-2-carboxamide |
| SMILES | C[C@@H](N)C(=O)O.NC(=O)C1CCS1 |
| InChI | InChI=1S/C4H7NOS.C3H7NO2/c5-4(6)3-1-2-7-3;1-2(4)3(5)6/h3H,1-2H2,(H2,5,6);2H,4H2,1H3,(H,5,6)/t;2-/m.1/s1 |
| InChIKey | NURLUWWCIIUURL-ARGLLVQISA-N |
| XLogP | -0.60 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-aminopropanoic acid;thietane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-aminopropanoic acid;thietane-2-carboxamide?
The IUPAC name of (2R)-2-aminopropanoic acid;thietane-2-carboxamide (CID 67611109) is (2R)-2-aminopropanoic acid;thietane-2-carboxamide.
What is the SMILES notation for (2R)-2-aminopropanoic acid;thietane-2-carboxamide?
The canonical SMILES for (2R)-2-aminopropanoic acid;thietane-2-carboxamide is C[C@@H](N)C(=O)O.NC(=O)C1CCS1.
What is the InChIKey of (2R)-2-aminopropanoic acid;thietane-2-carboxamide?
The InChIKey is NURLUWWCIIUURL-ARGLLVQISA-N. The full InChI is InChI=1S/C4H7NOS.C3H7NO2/c5-4(6)3-1-2-7-3;1-2(4)3(5)6/h3H,1-2H2,(H2,5,6);2H,4H2,1H3,(H,5,6)/t;2-/m.1/s1.
What are the key properties of (2R)-2-aminopropanoic acid;thietane-2-carboxamide?
(2R)-2-aminopropanoic acid;thietane-2-carboxamide has a molecular weight of 206.27 g/mol, XLogP of -0.60, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-aminopropanoic acid;thietane-2-carboxamide is sourced from PubChem (CID 67611109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).