C27H24ClN3O2 — CID 67611339
1-[[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]methyl]-1,3-diphenylurea (PubChem CID 67611339) has the molecular formula C27H24ClN3O2 and a molecular weight of 457.96 g/mol. Its IUPAC name is 1-[[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]methyl]-1,3-diphenylurea.
| Compound Name | 1-[[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]methyl]-1,3-diphenylurea |
|---|---|
| PubChem CID | 67611339 |
| Molecular Formula | C27H24ClN3O2 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 1-[[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]methyl]-1,3-diphenylurea |
| SMILES | Cc1cc(CN(C(=O)Nc2ccccc2)c2ccccc2)n(C)c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H24ClN3O2/c1-19-17-24(30(2)25(19)26(32)20-13-15-21(28)16-14-20)18-31(23-11-7-4-8-12-23)27(33)29-22-9-5-3-6-10-22/h3-17H,18H2,1-2H3,(H,29,33) |
| InChIKey | CNIXETHAZYSPGB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |