C23H24N2O5S — CID 67611362
[1-(5-benzoyl-1-methylpyrrol-2-yl)-2-phenyl-3-sulfamoylpropan-2-yl] acetate (PubChem CID 67611362) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is [1-(5-benzoyl-1-methylpyrrol-2-yl)-2-phenyl-3-sulfamoylpropan-2-yl] acetate.
| Compound Name | [1-(5-benzoyl-1-methylpyrrol-2-yl)-2-phenyl-3-sulfamoylpropan-2-yl] acetate |
|---|---|
| PubChem CID | 67611362 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [1-(5-benzoyl-1-methylpyrrol-2-yl)-2-phenyl-3-sulfamoylpropan-2-yl] acetate |
| SMILES | CC(=O)OC(Cc1ccc(C(=O)c2ccccc2)n1C)(CS(N)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O5S/c1-17(26)30-23(16-31(24,28)29,19-11-7-4-8-12-19)15-20-13-14-21(25(20)2)22(27)18-9-5-3-6-10-18/h3-14H,15-16H2,1-2H3,(H2,24,28,29) |
| InChIKey | QTFRROJILULJGF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |