C21H21ClN2O4S — CID 67611612
1-[5-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]-3-hydroxy-2-phenylpropane-2-sulfonamide (PubChem CID 67611612) has the molecular formula C21H21ClN2O4S and a molecular weight of 432.93 g/mol. Its IUPAC name is 1-[5-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]-3-hydroxy-2-phenylpropane-2-sulfonamide.
| Compound Name | 1-[5-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]-3-hydroxy-2-phenylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 67611612 |
| Molecular Formula | C21H21ClN2O4S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 1-[5-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]-3-hydroxy-2-phenylpropane-2-sulfonamide |
| SMILES | Cn1c(CC(CO)(c2ccccc2)S(N)(=O)=O)ccc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2O4S/c1-24-18(11-12-19(24)20(26)15-7-9-17(22)10-8-15)13-21(14-25,29(23,27)28)16-5-3-2-4-6-16/h2-12,25H,13-14H2,1H3,(H2,23,27,28) |
| InChIKey | ZORDJNNWEYEWBR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |