C21H22N2O4S — CID 67611137
2-[5-(4-methoxybenzoyl)-1-methylpyrrol-2-yl]-1-phenylethanesulfonamide (PubChem CID 67611137) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[5-(4-methoxybenzoyl)-1-methylpyrrol-2-yl]-1-phenylethanesulfonamide.
| Compound Name | 2-[5-(4-methoxybenzoyl)-1-methylpyrrol-2-yl]-1-phenylethanesulfonamide |
|---|---|
| PubChem CID | 67611137 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-[5-(4-methoxybenzoyl)-1-methylpyrrol-2-yl]-1-phenylethanesulfonamide |
| SMILES | COc1ccc(C(=O)c2ccc(CC(c3ccccc3)S(N)(=O)=O)n2C)cc1 |
| InChI | InChI=1S/C21H22N2O4S/c1-23-17(14-20(28(22,25)26)15-6-4-3-5-7-15)10-13-19(23)21(24)16-8-11-18(27-2)12-9-16/h3-13,20H,14H2,1-2H3,(H2,22,25,26) |
| InChIKey | PHQOIWXHTLHYFI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |