C29H48OSn — CID 67611860
tributyl(2-phenoxyethyl)stannane;1,2,3-trimethylbenzene (PubChem CID 67611860) has the molecular formula C29H48OSn and a molecular weight of 531.41 g/mol. Its IUPAC name is tributyl(2-phenoxyethyl)stannane;1,2,3-trimethylbenzene.
| Compound Name | tributyl(2-phenoxyethyl)stannane;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 67611860 |
| Molecular Formula | C29H48OSn |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | tributyl(2-phenoxyethyl)stannane;1,2,3-trimethylbenzene |
| SMILES | CCCC[Sn](CCCC)(CCCC)CCOc1ccccc1.Cc1cccc(C)c1C |
| InChI | InChI=1S/C9H12.C8H9O.3C4H9.Sn/c1-7-5-4-6-8(2)9(7)3;1-2-9-8-6-4-3-5-7-8;3*1-3-4-2;/h4-6H,1-3H3;3-7H,1-2H2;3*1,3-4H2,2H3; |
| InChIKey | CGQVDGZZUIZZOG-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |