C31H34FN3O5S — CID 67622262
(Z)-but-2-enedioic acid;N-[3-[2-[butyl(1H-pyrrol-3-ylmethyl)amino]ethyl]-2-methyl-1-benzothiophen-5-yl]-4-fluorobenzamide (PubChem CID 67622262) has the molecular formula C31H34FN3O5S and a molecular weight of 579.69 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-[3-[2-[butyl(1H-pyrrol-3-ylmethyl)amino]ethyl]-2-methyl-1-benzothiophen-5-yl]-4-fluorobenzamide.
| Compound Name | (Z)-but-2-enedioic acid;N-[3-[2-[butyl(1H-pyrrol-3-ylmethyl)amino]ethyl]-2-methyl-1-benzothiophen-5-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 67622262 |
| Molecular Formula | C31H34FN3O5S |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-[3-[2-[butyl(1H-pyrrol-3-ylmethyl)amino]ethyl]-2-methyl-1-benzothiophen-5-yl]-4-fluorobenzamide |
| SMILES | CCCCN(CCc1c(C)sc2ccc(NC(=O)c3ccc(F)cc3)cc12)Cc1cc[nH]c1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C27H30FN3OS.C4H4O4/c1-3-4-14-31(18-20-11-13-29-17-20)15-12-24-19(2)33-26-10-9-23(16-25(24)26)30-27(32)21-5-7-22(28)8-6-21;5-3(6)1-2-4(7)8/h5-11,13,16-17,29H,3-4,12,14-15,18H2,1-2H3,(H,30,32);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | HFFIJNSSAHORFU-BTJKTKAUSA-N |
| XLogP | 6.49 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|