C26H31NO5 — CID 67624521
2-[acetyloxymethyl-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl]carbamoyl]benzoic acid (PubChem CID 67624521) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[acetyloxymethyl-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl]carbamoyl]benzoic acid.
| Compound Name | 2-[acetyloxymethyl-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 67624521 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 2-[acetyloxymethyl-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl]carbamoyl]benzoic acid |
| SMILES | CC(=O)OCN(Cc1ccc2c(c1)C(C)(C)CCC2(C)C)C(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C26H31NO5/c1-17(28)32-16-27(23(29)19-8-6-7-9-20(19)24(30)31)15-18-10-11-21-22(14-18)26(4,5)13-12-25(21,2)3/h6-11,14H,12-13,15-16H2,1-5H3,(H,30,31) |
| InChIKey | LRFPEYHYAYIFHV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|