C25H34N4O2 — CID 67625685
N-ethyl-4-(2-methoxyphenyl)-1-piperazin-1-yl-N-pyridin-2-ylcyclohexane-1-carboxamide (PubChem CID 67625685) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-ethyl-4-(2-methoxyphenyl)-1-piperazin-1-yl-N-pyridin-2-ylcyclohexane-1-carboxamide.
| Compound Name | N-ethyl-4-(2-methoxyphenyl)-1-piperazin-1-yl-N-pyridin-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 67625685 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | N-ethyl-4-(2-methoxyphenyl)-1-piperazin-1-yl-N-pyridin-2-ylcyclohexane-1-carboxamide |
| SMILES | CCN(C(=O)C1(N2CCNCC2)CCC(c2ccccc2OC)CC1)c1ccccn1 |
| InChI | InChI=1S/C25H34N4O2/c1-3-29(23-10-6-7-15-27-23)24(30)25(28-18-16-26-17-19-28)13-11-20(12-14-25)21-8-4-5-9-22(21)31-2/h4-10,15,20,26H,3,11-14,16-19H2,1-2H3 |
| InChIKey | ZWFLBMNYSDLPQB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |