C21H23ClN2O5 — CID 67626568
(4-methoxyphenyl)methyl 2-(1-carbamoyl-4-hydroxypiperidin-2-yl)-5-chlorobenzoate (PubChem CID 67626568) has the molecular formula C21H23ClN2O5 and a molecular weight of 418.88 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-(1-carbamoyl-4-hydroxypiperidin-2-yl)-5-chlorobenzoate.
| Compound Name | (4-methoxyphenyl)methyl 2-(1-carbamoyl-4-hydroxypiperidin-2-yl)-5-chlorobenzoate |
|---|---|
| PubChem CID | 67626568 |
| Molecular Formula | C21H23ClN2O5 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-(1-carbamoyl-4-hydroxypiperidin-2-yl)-5-chlorobenzoate |
| SMILES | COc1ccc(COC(=O)c2cc(Cl)ccc2C2CC(O)CCN2C(N)=O)cc1 |
| InChI | InChI=1S/C21H23ClN2O5/c1-28-16-5-2-13(3-6-16)12-29-20(26)18-10-14(22)4-7-17(18)19-11-15(25)8-9-24(19)21(23)27/h2-7,10,15,19,25H,8-9,11-12H2,1H3,(H2,23,27) |
| InChIKey | JVJGARHGJNDLFZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |