C31H34O5 — CID 67627461
2-[2-[2-(4-acetyloxybutoxy)-3-(1-adamantyl)phenyl]ethynyl]benzoic acid (PubChem CID 67627461) has the molecular formula C31H34O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is 2-[2-[2-(4-acetyloxybutoxy)-3-(1-adamantyl)phenyl]ethynyl]benzoic acid.
| Compound Name | 2-[2-[2-(4-acetyloxybutoxy)-3-(1-adamantyl)phenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 67627461 |
| Molecular Formula | C31H34O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 2-[2-[2-(4-acetyloxybutoxy)-3-(1-adamantyl)phenyl]ethynyl]benzoic acid |
| SMILES | CC(=O)OCCCCOc1c(C#Cc2ccccc2C(=O)O)cccc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C31H34O5/c1-21(32)35-13-4-5-14-36-29-26(12-11-25-7-2-3-9-27(25)30(33)34)8-6-10-28(29)31-18-22-15-23(19-31)17-24(16-22)20-31/h2-3,6-10,22-24H,4-5,13-20H2,1H3,(H,33,34) |
| InChIKey | UBCBMMRRFZOWSV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|