C25H35ClO — CID 67632622
(5S,6R,8S,9S,10R,13S,14S)-6-(4-chlorophenoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 67632622) has the molecular formula C25H35ClO and a molecular weight of 387.01 g/mol. Its IUPAC name is (5S,6R,8S,9S,10R,13S,14S)-6-(4-chlorophenoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (5S,6R,8S,9S,10R,13S,14S)-6-(4-chlorophenoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 67632622 |
| Molecular Formula | C25H35ClO |
| Molecular Weight | 387.01 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (5S,6R,8S,9S,10R,13S,14S)-6-(4-chlorophenoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1C[C@@H](Oc3ccc(Cl)cc3)[C@H]3CCCC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C25H35ClO/c1-24-13-5-7-20(24)19-16-23(27-18-10-8-17(26)9-11-18)22-6-3-4-14-25(22,2)21(19)12-15-24/h8-11,19-23H,3-7,12-16H2,1-2H3/t19-,20-,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | WBNUFLKRULHVHE-MHVKPSTLSA-N |
| XLogP | 7.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.01 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |