C24H19Cl2N3O2 — CID 67636495
2,6-dichloro-N-(2-ethyl-1-phenacylbenzimidazol-4-yl)benzamide (PubChem CID 67636495) has the molecular formula C24H19Cl2N3O2 and a molecular weight of 452.34 g/mol. Its IUPAC name is 2,6-dichloro-N-(2-ethyl-1-phenacylbenzimidazol-4-yl)benzamide.
| Compound Name | 2,6-dichloro-N-(2-ethyl-1-phenacylbenzimidazol-4-yl)benzamide |
|---|---|
| PubChem CID | 67636495 |
| Molecular Formula | C24H19Cl2N3O2 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 2,6-dichloro-N-(2-ethyl-1-phenacylbenzimidazol-4-yl)benzamide |
| SMILES | CCc1nc2c(NC(=O)c3c(Cl)cccc3Cl)cccc2n1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H19Cl2N3O2/c1-2-21-28-23-18(27-24(31)22-16(25)10-6-11-17(22)26)12-7-13-19(23)29(21)14-20(30)15-8-4-3-5-9-15/h3-13H,2,14H2,1H3,(H,27,31) |
| InChIKey | BDRSZWPGAKAPPQ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |