C14H17N3O2 — CID 67636563
2-nitro-N-pentylquinolin-4-amine (PubChem CID 67636563) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-nitro-N-pentylquinolin-4-amine.
| Compound Name | 2-nitro-N-pentylquinolin-4-amine |
|---|---|
| PubChem CID | 67636563 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-nitro-N-pentylquinolin-4-amine |
| SMILES | CCCCCNc1cc([N+](=O)[O-])nc2ccccc12 |
| InChI | InChI=1S/C14H17N3O2/c1-2-3-6-9-15-13-10-14(17(18)19)16-12-8-5-4-7-11(12)13/h4-5,7-8,10H,2-3,6,9H2,1H3,(H,15,16) |
| InChIKey | XBCGFFLDSVYRSC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|