C42H61NO7Si — CID 67640315
(2,11-dihydroxy-12,15,15-trimethyl-9-methylidene-13-tetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7-trienyl) 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-tri(propan-2-yl)silyloxyphenyl]propanoate (PubChem CID 67640315) has the molecular formula C42H61NO7Si and a molecular weight of 720.04 g/mol. Its IUPAC name is (2,11-dihydroxy-12,15,15-trimethyl-9-methylidene-13-tetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7-trienyl) 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-tri(propan-2-yl)silyloxyphenyl]propanoate.
| Compound Name | (2,11-dihydroxy-12,15,15-trimethyl-9-methylidene-13-tetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7-trienyl) 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-tri(propan-2-yl)silyloxyphenyl]propanoate |
|---|---|
| PubChem CID | 67640315 |
| Molecular Formula | C42H61NO7Si |
| Molecular Weight | 720.04 g/mol |
| Exact Mass | 719.42 |
| IUPAC Name | (2,11-dihydroxy-12,15,15-trimethyl-9-methylidene-13-tetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7-trienyl) 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-tri(propan-2-yl)silyloxyphenyl]propanoate |
| SMILES | C=C1CC2(O)C(O)(c3ccccc31)C1CC(OC(=O)CCc3cccc(NC(=O)OC(C)(C)C)c3O[Si](C(C)C)(C(C)C)C(C)C)C2(C)C1(C)C |
| InChI | InChI=1S/C42H61NO7Si/c1-25(2)51(26(3)4,27(5)6)50-36-29(17-16-20-32(36)43-37(45)49-38(8,9)10)21-22-35(44)48-34-23-33-39(11,12)40(34,13)41(46)24-28(7)30-18-14-15-19-31(30)42(33,41)47/h14-20,25-27,33-34,46-47H,7,21-24H2,1-6,8-13H3,(H,43,45) |
| InChIKey | KETQJBSEQJXWIO-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.04 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|