C37H50O4Si — CID 159599324
(11,16,16-trimethyl-8-methylidene-15-oxapentacyclo[8.4.1.111,14.01,10.02,7]hexadeca-2,4,6-trien-12-yl) 3-[2-tri(propan-2-yl)silyloxyphenyl]propanoate (PubChem CID 159599324) has the molecular formula C37H50O4Si and a molecular weight of 586.89 g/mol. Its IUPAC name is (11,16,16-trimethyl-8-methylidene-15-oxapentacyclo[8.4.1.111,14.01,10.02,7]hexadeca-2,4,6-trien-12-yl) 3-[2-tri(propan-2-yl)silyloxyphenyl]propanoate.
| Compound Name | (11,16,16-trimethyl-8-methylidene-15-oxapentacyclo[8.4.1.111,14.01,10.02,7]hexadeca-2,4,6-trien-12-yl) 3-[2-tri(propan-2-yl)silyloxyphenyl]propanoate |
|---|---|
| PubChem CID | 159599324 |
| Molecular Formula | C37H50O4Si |
| Molecular Weight | 586.89 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | (11,16,16-trimethyl-8-methylidene-15-oxapentacyclo[8.4.1.111,14.01,10.02,7]hexadeca-2,4,6-trien-12-yl) 3-[2-tri(propan-2-yl)silyloxyphenyl]propanoate |
| SMILES | C=C1CC23OC2(c2ccccc21)C1CC(OC(=O)CCc2ccccc2O[Si](C(C)C)(C(C)C)C(C)C)C3(C)C1(C)C |
| InChI | InChI=1S/C37H50O4Si/c1-23(2)42(24(3)4,25(5)6)40-30-18-14-11-15-27(30)19-20-33(38)39-32-21-31-34(8,9)35(32,10)36-22-26(7)28-16-12-13-17-29(28)37(31,36)41-36/h11-18,23-25,31-32H,7,19-22H2,1-6,8-10H3 |
| InChIKey | MLGMSLUEJCOGSC-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.89 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|