C20H24N2O3S — CID 67640573
2-(4-octoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxylic acid (PubChem CID 67640573) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-(4-octoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxylic acid.
| Compound Name | 2-(4-octoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 67640573 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-(4-octoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
| SMILES | CCCCCCCCOc1ccc(-c2cn3cc(C(=O)O)nc3s2)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-2-3-4-5-6-7-12-25-16-10-8-15(9-11-16)18-14-22-13-17(19(23)24)21-20(22)26-18/h8-11,13-14H,2-7,12H2,1H3,(H,23,24) |
| InChIKey | PLXOHJICYCKJNW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|