C26H25NO4S — CID 67643985
[5-(2,2-diphenylethenylsulfonylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] acetate (PubChem CID 67643985) has the molecular formula C26H25NO4S and a molecular weight of 447.56 g/mol. Its IUPAC name is [5-(2,2-diphenylethenylsulfonylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] acetate.
| Compound Name | [5-(2,2-diphenylethenylsulfonylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 67643985 |
| Molecular Formula | C26H25NO4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [5-(2,2-diphenylethenylsulfonylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1cccc2c1CCCC2NS(=O)(=O)C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H25NO4S/c1-19(28)31-26-17-9-14-22-23(26)15-8-16-25(22)27-32(29,30)18-24(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-7,9-14,17-18,25,27H,8,15-16H2,1H3 |
| InChIKey | NWFVCWFYLFQEBV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|