C16H26N4O4 — CID 67644607
1-amino-3-[(2,4-dihydroxybenzoyl)amino]-1-octylurea (PubChem CID 67644607) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-amino-3-[(2,4-dihydroxybenzoyl)amino]-1-octylurea.
| Compound Name | 1-amino-3-[(2,4-dihydroxybenzoyl)amino]-1-octylurea |
|---|---|
| PubChem CID | 67644607 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-amino-3-[(2,4-dihydroxybenzoyl)amino]-1-octylurea |
| SMILES | CCCCCCCCN(N)C(=O)NNC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H26N4O4/c1-2-3-4-5-6-7-10-20(17)16(24)19-18-15(23)13-9-8-12(21)11-14(13)22/h8-9,11,21-22H,2-7,10,17H2,1H3,(H,18,23)(H,19,24) |
| InChIKey | VVYPLRQOXDSYQI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|