C20H23FN4O2S — CID 67644997
N-[1-[2-(dimethylamino)ethyl]-4-(3-fluoro-4-methylphenyl)pyrazol-3-yl]benzenesulfonamide (PubChem CID 67644997) has the molecular formula C20H23FN4O2S and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethyl]-4-(3-fluoro-4-methylphenyl)pyrazol-3-yl]benzenesulfonamide.
| Compound Name | N-[1-[2-(dimethylamino)ethyl]-4-(3-fluoro-4-methylphenyl)pyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67644997 |
| Molecular Formula | C20H23FN4O2S |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethyl]-4-(3-fluoro-4-methylphenyl)pyrazol-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2cn(CCN(C)C)nc2NS(=O)(=O)c2ccccc2)cc1F |
| InChI | InChI=1S/C20H23FN4O2S/c1-15-9-10-16(13-19(15)21)18-14-25(12-11-24(2)3)22-20(18)23-28(26,27)17-7-5-4-6-8-17/h4-10,13-14H,11-12H2,1-3H3,(H,22,23) |
| InChIKey | MLKGBBQPEVBTDG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |