C19H14FN5O3S — CID 67645494
N-[5-cyano-1-(cyanomethyl)-4-(3-fluoro-4-methoxyphenyl)pyrazol-3-yl]benzenesulfonamide (PubChem CID 67645494) has the molecular formula C19H14FN5O3S and a molecular weight of 411.42 g/mol. Its IUPAC name is N-[5-cyano-1-(cyanomethyl)-4-(3-fluoro-4-methoxyphenyl)pyrazol-3-yl]benzenesulfonamide.
| Compound Name | N-[5-cyano-1-(cyanomethyl)-4-(3-fluoro-4-methoxyphenyl)pyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67645494 |
| Molecular Formula | C19H14FN5O3S |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-[5-cyano-1-(cyanomethyl)-4-(3-fluoro-4-methoxyphenyl)pyrazol-3-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2c(NS(=O)(=O)c3ccccc3)nn(CC#N)c2C#N)cc1F |
| InChI | InChI=1S/C19H14FN5O3S/c1-28-17-8-7-13(11-15(17)20)18-16(12-22)25(10-9-21)23-19(18)24-29(26,27)14-5-3-2-4-6-14/h2-8,11H,10H2,1H3,(H,23,24) |
| InChIKey | YYHOUDSFQDRVRG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |