C23H22N2O2 — CID 67648386
3,6-dibenzylidene-5-but-3-enoxy-1-methylpyrazin-2-one (PubChem CID 67648386) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3,6-dibenzylidene-5-but-3-enoxy-1-methylpyrazin-2-one.
| Compound Name | 3,6-dibenzylidene-5-but-3-enoxy-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 67648386 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3,6-dibenzylidene-5-but-3-enoxy-1-methylpyrazin-2-one |
| SMILES | C=CCCOc1nc(=Cc2ccccc2)c(=O)n(C)c1=Cc1ccccc1 |
| InChI | InChI=1S/C23H22N2O2/c1-3-4-15-27-22-21(17-19-13-9-6-10-14-19)25(2)23(26)20(24-22)16-18-11-7-5-8-12-18/h3,5-14,16-17H,1,4,15H2,2H3 |
| InChIKey | JIHDVTRNYNCPON-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|