C37H34N4O6 — CID 67577299
tert-butyl 3-[(Z)-[(5Z)-5-benzylidene-6-[3-(1,3-dioxoisoindol-2-yl)propoxy]-4-methyl-3-oxopyrazin-2-ylidene]methyl]indole-1-carboxylate (PubChem CID 67577299) has the molecular formula C37H34N4O6 and a molecular weight of 630.70 g/mol. Its IUPAC name is tert-butyl 3-[(Z)-[(5Z)-5-benzylidene-6-[3-(1,3-dioxoisoindol-2-yl)propoxy]-4-methyl-3-oxopyrazin-2-ylidene]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(Z)-[(5Z)-5-benzylidene-6-[3-(1,3-dioxoisoindol-2-yl)propoxy]-4-methyl-3-oxopyrazin-2-ylidene]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 67577299 |
| Molecular Formula | C37H34N4O6 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | tert-butyl 3-[(Z)-[(5Z)-5-benzylidene-6-[3-(1,3-dioxoisoindol-2-yl)propoxy]-4-methyl-3-oxopyrazin-2-ylidene]methyl]indole-1-carboxylate |
| SMILES | Cn1c(=O)/c(=C/c2cn(C(=O)OC(C)(C)C)c3ccccc23)nc(OCCCN2C(=O)c3ccccc3C2=O)/c1=C/c1ccccc1 |
| InChI | InChI=1S/C37H34N4O6/c1-37(2,3)47-36(45)41-23-25(26-15-10-11-18-30(26)41)22-29-35(44)39(4)31(21-24-13-6-5-7-14-24)32(38-29)46-20-12-19-40-33(42)27-16-8-9-17-28(27)34(40)43/h5-11,13-18,21-23H,12,19-20H2,1-4H3/b29-22-,31-21- |
| InChIKey | UHSKEIHCDKMXOU-JQMJHSMFSA-N |
| XLogP | 4.24 |
| TPSA | 112.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|