C15H23N5S — CID 67648605
N,1-dimethylpiperidin-4-amine;3-phenyl-1,2,4-thiadiazol-5-amine (PubChem CID 67648605) has the molecular formula C15H23N5S and a molecular weight of 305.45 g/mol. Its IUPAC name is N,1-dimethylpiperidin-4-amine;3-phenyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N,1-dimethylpiperidin-4-amine;3-phenyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 67648605 |
| Molecular Formula | C15H23N5S |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N,1-dimethylpiperidin-4-amine;3-phenyl-1,2,4-thiadiazol-5-amine |
| SMILES | CNC1CCN(C)CC1.Nc1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C8H7N3S.C7H16N2/c9-8-10-7(11-12-8)6-4-2-1-3-5-6;1-8-7-3-5-9(2)6-4-7/h1-5H,(H2,9,10,11);7-8H,3-6H2,1-2H3 |
| InChIKey | BJPOGZQHRTYJPM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |