C34H44NO5P — CID 67649039
methyl (2S)-2-(N-[2-[[methoxy(4-phenylbutyl)phosphoryl]methyl]-4-methylpentanoyl]-4-phenylanilino)propanoate (PubChem CID 67649039) has the molecular formula C34H44NO5P and a molecular weight of 577.70 g/mol. Its IUPAC name is methyl (2S)-2-(N-[2-[[methoxy(4-phenylbutyl)phosphoryl]methyl]-4-methylpentanoyl]-4-phenylanilino)propanoate.
| Compound Name | methyl (2S)-2-(N-[2-[[methoxy(4-phenylbutyl)phosphoryl]methyl]-4-methylpentanoyl]-4-phenylanilino)propanoate |
|---|---|
| PubChem CID | 67649039 |
| Molecular Formula | C34H44NO5P |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | methyl (2S)-2-(N-[2-[[methoxy(4-phenylbutyl)phosphoryl]methyl]-4-methylpentanoyl]-4-phenylanilino)propanoate |
| SMILES | COC(=O)[C@H](C)N(C(=O)C(CC(C)C)CP(=O)(CCCCc1ccccc1)OC)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H44NO5P/c1-26(2)24-31(25-41(38,40-5)23-13-12-16-28-14-8-6-9-15-28)33(36)35(27(3)34(37)39-4)32-21-19-30(20-22-32)29-17-10-7-11-18-29/h6-11,14-15,17-22,26-27,31H,12-13,16,23-25H2,1-5H3/t27-,31?,41?/m0/s1 |
| InChIKey | GUSXYEWGVVGCSC-LGZWHMSCSA-N |
| XLogP | 7.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|