C27H30NO5P — CID 67676423
(2R)-2-(N-acetyl-4-phenylanilino)-2-[hydroxy(4-phenylbutyl)phosphoryl]propanoic acid (PubChem CID 67676423) has the molecular formula C27H30NO5P and a molecular weight of 479.51 g/mol. Its IUPAC name is (2R)-2-(N-acetyl-4-phenylanilino)-2-[hydroxy(4-phenylbutyl)phosphoryl]propanoic acid.
| Compound Name | (2R)-2-(N-acetyl-4-phenylanilino)-2-[hydroxy(4-phenylbutyl)phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 67676423 |
| Molecular Formula | C27H30NO5P |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (2R)-2-(N-acetyl-4-phenylanilino)-2-[hydroxy(4-phenylbutyl)phosphoryl]propanoic acid |
| SMILES | CC(=O)N(c1ccc(-c2ccccc2)cc1)[C@@](C)(C(=O)O)P(=O)(O)CCCCc1ccccc1 |
| InChI | InChI=1S/C27H30NO5P/c1-21(29)28(25-18-16-24(17-19-25)23-14-7-4-8-15-23)27(2,26(30)31)34(32,33)20-10-9-13-22-11-5-3-6-12-22/h3-8,11-12,14-19H,9-10,13,20H2,1-2H3,(H,30,31)(H,32,33)/t27-/m1/s1 |
| InChIKey | GRXMQVWZZFTMSE-HHHXNRCGSA-N |
| XLogP | 5.80 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|