C16H24NO6P — CID 67908233
methyl 3-[methoxy-[2-(phenylmethoxycarbonylamino)ethyl]phosphoryl]-2-methylpropanoate (PubChem CID 67908233) has the molecular formula C16H24NO6P and a molecular weight of 357.34 g/mol. Its IUPAC name is methyl 3-[methoxy-[2-(phenylmethoxycarbonylamino)ethyl]phosphoryl]-2-methylpropanoate.
| Compound Name | methyl 3-[methoxy-[2-(phenylmethoxycarbonylamino)ethyl]phosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 67908233 |
| Molecular Formula | C16H24NO6P |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | methyl 3-[methoxy-[2-(phenylmethoxycarbonylamino)ethyl]phosphoryl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CP(=O)(CCNC(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C16H24NO6P/c1-13(15(18)21-2)12-24(20,22-3)10-9-17-16(19)23-11-14-7-5-4-6-8-14/h4-8,13H,9-12H2,1-3H3,(H,17,19) |
| InChIKey | SFSBCZYVQRNWLP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|