C26H36NO6P — CID 67831648
tert-butyl (2R)-2-[[methoxy-[2-(phenylmethoxycarbonylamino)ethyl]phosphoryl]methyl]-4-phenylbutanoate (PubChem CID 67831648) has the molecular formula C26H36NO6P and a molecular weight of 489.55 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[methoxy-[2-(phenylmethoxycarbonylamino)ethyl]phosphoryl]methyl]-4-phenylbutanoate.
| Compound Name | tert-butyl (2R)-2-[[methoxy-[2-(phenylmethoxycarbonylamino)ethyl]phosphoryl]methyl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 67831648 |
| Molecular Formula | C26H36NO6P |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | tert-butyl (2R)-2-[[methoxy-[2-(phenylmethoxycarbonylamino)ethyl]phosphoryl]methyl]-4-phenylbutanoate |
| SMILES | CO[P@](=O)(CCNC(=O)OCc1ccccc1)CC(CCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H36NO6P/c1-26(2,3)33-24(28)23(16-15-21-11-7-5-8-12-21)20-34(30,31-4)18-17-27-25(29)32-19-22-13-9-6-10-14-22/h5-14,23H,15-20H2,1-4H3,(H,27,29)/t23?,34-/m1/s1 |
| InChIKey | PDIKPJCZAOLVCW-QISPJVBOSA-N |
| XLogP | 5.43 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|