C23H36N4O2 — CID 67650465
N-hexyl-2-[4-[1-[(1-hydroxy-3-imidazol-1-ylpropyl)amino]propan-2-yl]phenyl]acetamide (PubChem CID 67650465) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is N-hexyl-2-[4-[1-[(1-hydroxy-3-imidazol-1-ylpropyl)amino]propan-2-yl]phenyl]acetamide.
| Compound Name | N-hexyl-2-[4-[1-[(1-hydroxy-3-imidazol-1-ylpropyl)amino]propan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 67650465 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | N-hexyl-2-[4-[1-[(1-hydroxy-3-imidazol-1-ylpropyl)amino]propan-2-yl]phenyl]acetamide |
| SMILES | CCCCCCNC(=O)Cc1ccc(C(C)CNC(O)CCn2ccnc2)cc1 |
| InChI | InChI=1S/C23H36N4O2/c1-3-4-5-6-12-25-23(29)16-20-7-9-21(10-8-20)19(2)17-26-22(28)11-14-27-15-13-24-18-27/h7-10,13,15,18-19,22,26,28H,3-6,11-12,14,16-17H2,1-2H3,(H,25,29) |
| InChIKey | IHZZRQDAGJKFOO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|